C14H19N3O3S — CID 107849026
6-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]hexan-1-ol (PubChem CID 107849026) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 6-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]hexan-1-ol.
| Compound Name | 6-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 107849026 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 6-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]hexan-1-ol |
| SMILES | Cc1nc2cc(NCCCCCCO)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C14H19N3O3S/c1-10-16-12-8-11(15-6-4-2-3-5-7-18)13(17(19)20)9-14(12)21-10/h8-9,15,18H,2-7H2,1H3 |
| InChIKey | BEQRNDZIZCHONZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|