C11H12N4O4S — CID 83203397
2-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]ethyl carbamate (PubChem CID 83203397) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]ethyl carbamate.
| Compound Name | 2-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83203397 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]ethyl carbamate |
| SMILES | Cc1nc2cc(NCCOC(N)=O)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C11H12N4O4S/c1-6-14-8-4-7(13-2-3-19-11(12)16)9(15(17)18)5-10(8)20-6/h4-5,13H,2-3H2,1H3,(H2,12,16) |
| InChIKey | ABRMZKMJDPREOF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|