C14H19N3O3S — CID 106350500
4-methyl-3-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]pentan-1-ol (PubChem CID 106350500) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 4-methyl-3-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]pentan-1-ol.
| Compound Name | 4-methyl-3-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 106350500 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-methyl-3-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)amino]pentan-1-ol |
| SMILES | Cc1nc2cc(NC(CCO)C(C)C)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C14H19N3O3S/c1-8(2)10(4-5-18)16-11-6-12-14(21-9(3)15-12)7-13(11)17(19)20/h6-8,10,16,18H,4-5H2,1-3H3 |
| InChIKey | IBEZQSRVUIJWOE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|