C14H20N4O2S — CID 80698347
2-N-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)hexane-1,2-diamine (PubChem CID 80698347) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-N-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)hexane-1,2-diamine.
| Compound Name | 2-N-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)hexane-1,2-diamine |
|---|---|
| PubChem CID | 80698347 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-N-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)hexane-1,2-diamine |
| SMILES | CCCCC(CN)Nc1cc2nc(C)sc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N4O2S/c1-3-4-5-10(8-15)17-11-6-12-14(21-9(2)16-12)7-13(11)18(19)20/h6-7,10,17H,3-5,8,15H2,1-2H3 |
| InChIKey | XUWTUXGBIUBKGH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|