C13H17N3O2S — CID 63550367
2-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)pentan-3-amine (PubChem CID 63550367) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)pentan-3-amine.
| Compound Name | 2-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)pentan-3-amine |
|---|---|
| PubChem CID | 63550367 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)pentan-3-amine |
| SMILES | CCC(N)C(C)c1cc2nc(C)sc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N3O2S/c1-4-10(14)7(2)9-5-11-13(19-8(3)15-11)6-12(9)16(17)18/h5-7,10H,4,14H2,1-3H3 |
| InChIKey | VQLWLUQKHRFKNH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|