C12H14N2O4S — CID 63200652
1-methoxy-3-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)propan-2-ol (PubChem CID 63200652) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 1-methoxy-3-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)propan-2-ol.
| Compound Name | 1-methoxy-3-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 63200652 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-methoxy-3-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)propan-2-ol |
| SMILES | COCC(O)Cc1cc2nc(C)sc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N2O4S/c1-7-13-10-4-8(3-9(15)6-18-2)11(14(16)17)5-12(10)19-7/h4-5,9,15H,3,6H2,1-2H3 |
| InChIKey | MGKWBJLZABSIHY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|