C18H17N3O2S2 — CID 159179835
2,5-dimethyl-1,3-benzothiazole;2,5-dimethyl-6-nitro-1,3-benzothiazole (PubChem CID 159179835) has the molecular formula C18H17N3O2S2 and a molecular weight of 371.49 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-benzothiazole;2,5-dimethyl-6-nitro-1,3-benzothiazole.
| Compound Name | 2,5-dimethyl-1,3-benzothiazole;2,5-dimethyl-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 159179835 |
| Molecular Formula | C18H17N3O2S2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2,5-dimethyl-1,3-benzothiazole;2,5-dimethyl-6-nitro-1,3-benzothiazole |
| SMILES | Cc1ccc2sc(C)nc2c1.Cc1nc2cc(C)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C9H8N2O2S.C9H9NS/c1-5-3-7-9(14-6(2)10-7)4-8(5)11(12)13;1-6-3-4-9-8(5-6)10-7(2)11-9/h3-4H,1-2H3;3-5H,1-2H3 |
| InChIKey | KMTASFHKNQJJQI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|