C14H10N2O4S — CID 60870483
3-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)oxy]phenol (PubChem CID 60870483) has the molecular formula C14H10N2O4S and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)oxy]phenol.
| Compound Name | 3-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)oxy]phenol |
|---|---|
| PubChem CID | 60870483 |
| Molecular Formula | C14H10N2O4S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-[(2-methyl-6-nitro-1,3-benzothiazol-5-yl)oxy]phenol |
| SMILES | Cc1nc2cc(Oc3cccc(O)c3)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C14H10N2O4S/c1-8-15-11-6-13(12(16(18)19)7-14(11)21-8)20-10-4-2-3-9(17)5-10/h2-7,17H,1H3 |
| InChIKey | RIOYQRCLVDPIQV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|