C14H11IN2OS — CID 43450725
5-(3-iodophenoxy)-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 43450725) has the molecular formula C14H11IN2OS and a molecular weight of 382.23 g/mol. Its IUPAC name is 5-(3-iodophenoxy)-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | 5-(3-iodophenoxy)-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 43450725 |
| Molecular Formula | C14H11IN2OS |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 5-(3-iodophenoxy)-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | Cc1nc2cc(Oc3cccc(I)c3)c(N)cc2s1 |
| InChI | InChI=1S/C14H11IN2OS/c1-8-17-12-7-13(11(16)6-14(12)19-8)18-10-4-2-3-9(15)5-10/h2-7H,16H2,1H3 |
| InChIKey | NFAYITWIWTVNES-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|