C14H10ClFN2OS — CID 63878978
5-(3-chloro-4-fluorophenoxy)-2-methyl-1,3-benzothiazol-6-amine (PubChem CID 63878978) has the molecular formula C14H10ClFN2OS and a molecular weight of 308.77 g/mol. Its IUPAC name is 5-(3-chloro-4-fluorophenoxy)-2-methyl-1,3-benzothiazol-6-amine.
| Compound Name | 5-(3-chloro-4-fluorophenoxy)-2-methyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 63878978 |
| Molecular Formula | C14H10ClFN2OS |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 5-(3-chloro-4-fluorophenoxy)-2-methyl-1,3-benzothiazol-6-amine |
| SMILES | Cc1nc2cc(Oc3ccc(F)c(Cl)c3)c(N)cc2s1 |
| InChI | InChI=1S/C14H10ClFN2OS/c1-7-18-12-6-13(11(17)5-14(12)20-7)19-8-2-3-10(16)9(15)4-8/h2-6H,17H2,1H3 |
| InChIKey | YDTMGBUQGPAHHB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|