C13H16N4O2S — CID 43556910
1-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)piperidin-4-amine (PubChem CID 43556910) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 1-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)piperidin-4-amine.
| Compound Name | 1-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 43556910 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)piperidin-4-amine |
| SMILES | Cc1nc2cc(N3CCC(N)CC3)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C13H16N4O2S/c1-8-15-10-6-11(16-4-2-9(14)3-5-16)12(17(18)19)7-13(10)20-8/h6-7,9H,2-5,14H2,1H3 |
| InChIKey | YQIXLGHKTTUKFW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|