C13H15N3O4S — CID 81209113
[4-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)morpholin-2-yl]methanol (PubChem CID 81209113) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is [4-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)morpholin-2-yl]methanol.
| Compound Name | [4-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81209113 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | [4-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)morpholin-2-yl]methanol |
| SMILES | Cc1nc2cc(N3CCOC(CO)C3)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C13H15N3O4S/c1-8-14-10-4-11(12(16(18)19)5-13(10)21-8)15-2-3-20-9(6-15)7-17/h4-5,9,17H,2-3,6-7H2,1H3 |
| InChIKey | FEJHVDVZEJRZCS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|