C13H13N3O4S — CID 64616645
2-[1-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)azetidin-3-yl]acetic acid (PubChem CID 64616645) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-[1-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 64616645 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-[1-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)azetidin-3-yl]acetic acid |
| SMILES | Cc1nc2cc(N3CC(CC(=O)O)C3)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C13H13N3O4S/c1-7-14-9-3-10(11(16(19)20)4-12(9)21-7)15-5-8(6-15)2-13(17)18/h3-4,8H,2,5-6H2,1H3,(H,17,18) |
| InChIKey | OVKOWZWGDFNLCW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|