C13H16N4O3S — CID 114399381
[4-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)morpholin-2-yl]methanamine (PubChem CID 114399381) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is [4-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)morpholin-2-yl]methanamine.
| Compound Name | [4-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 114399381 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [4-(2-methyl-6-nitro-1,3-benzothiazol-5-yl)morpholin-2-yl]methanamine |
| SMILES | Cc1nc2cc(N3CCOC(CN)C3)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C13H16N4O3S/c1-8-15-10-4-11(12(17(18)19)5-13(10)21-8)16-2-3-20-9(6-14)7-16/h4-5,9H,2-3,6-7,14H2,1H3 |
| InChIKey | FXALDEQJHFNDOB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|