C12H11N5O2S — CID 79781355
2-methyl-N-(1-methylpyrazol-3-yl)-6-nitro-1,3-benzothiazol-5-amine (PubChem CID 79781355) has the molecular formula C12H11N5O2S and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-methyl-N-(1-methylpyrazol-3-yl)-6-nitro-1,3-benzothiazol-5-amine.
| Compound Name | 2-methyl-N-(1-methylpyrazol-3-yl)-6-nitro-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 79781355 |
| Molecular Formula | C12H11N5O2S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-methyl-N-(1-methylpyrazol-3-yl)-6-nitro-1,3-benzothiazol-5-amine |
| SMILES | Cc1nc2cc(Nc3ccn(C)n3)c([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C12H11N5O2S/c1-7-13-9-5-8(14-12-3-4-16(2)15-12)10(17(18)19)6-11(9)20-7/h3-6H,1-2H3,(H,14,15) |
| InChIKey | YDQWNCHFEAXIQE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|