C11H14Cl2N2O3 — CID 107318103
5-(4,5-dichloro-2-nitroanilino)pentan-1-ol (PubChem CID 107318103) has the molecular formula C11H14Cl2N2O3 and a molecular weight of 293.15 g/mol. Its IUPAC name is 5-(4,5-dichloro-2-nitroanilino)pentan-1-ol.
| Compound Name | 5-(4,5-dichloro-2-nitroanilino)pentan-1-ol |
|---|---|
| PubChem CID | 107318103 |
| Molecular Formula | C11H14Cl2N2O3 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 5-(4,5-dichloro-2-nitroanilino)pentan-1-ol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1NCCCCCO |
| InChI | InChI=1S/C11H14Cl2N2O3/c12-8-6-10(14-4-2-1-3-5-16)11(15(17)18)7-9(8)13/h6-7,14,16H,1-5H2 |
| InChIKey | BCJYRZWCCRTOQR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|