C14H10Cl4N4O4 — CID 91716539
N,N'-bis(4,5-dichloro-2-nitrophenyl)ethane-1,2-diamine (PubChem CID 91716539) has the molecular formula C14H10Cl4N4O4 and a molecular weight of 440.07 g/mol. Its IUPAC name is N,N'-bis(4,5-dichloro-2-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(4,5-dichloro-2-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 91716539 |
| Molecular Formula | C14H10Cl4N4O4 |
| Molecular Weight | 440.07 g/mol |
| Exact Mass | 437.95 |
| IUPAC Name | N,N'-bis(4,5-dichloro-2-nitrophenyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1NCCNc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10Cl4N4O4/c15-7-3-11(13(21(23)24)5-9(7)17)19-1-2-20-12-4-8(16)10(18)6-14(12)22(25)26/h3-6,19-20H,1-2H2 |
| InChIKey | JPNMXKGDPROGQP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.07 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|