C9H11Cl2N3O4S — CID 106337736
2-(4,5-dichloro-2-nitroanilino)-N-methylethanesulfonamide (PubChem CID 106337736) has the molecular formula C9H11Cl2N3O4S and a molecular weight of 328.18 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-nitroanilino)-N-methylethanesulfonamide.
| Compound Name | 2-(4,5-dichloro-2-nitroanilino)-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106337736 |
| Molecular Formula | C9H11Cl2N3O4S |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 2-(4,5-dichloro-2-nitroanilino)-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11Cl2N3O4S/c1-12-19(17,18)3-2-13-8-4-6(10)7(11)5-9(8)14(15)16/h4-5,12-13H,2-3H2,1H3 |
| InChIKey | UELBJANPIGNULP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|