C8H11Cl2N3O2 — CID 159967035
4,5-dichloro-N-methyl-2-nitroaniline;methanamine (PubChem CID 159967035) has the molecular formula C8H11Cl2N3O2 and a molecular weight of 252.10 g/mol. Its IUPAC name is 4,5-dichloro-N-methyl-2-nitroaniline;methanamine.
| Compound Name | 4,5-dichloro-N-methyl-2-nitroaniline;methanamine |
|---|---|
| PubChem CID | 159967035 |
| Molecular Formula | C8H11Cl2N3O2 |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 4,5-dichloro-N-methyl-2-nitroaniline;methanamine |
| SMILES | CN.CNc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6Cl2N2O2.CH5N/c1-10-6-2-4(8)5(9)3-7(6)11(12)13;1-2/h2-3,10H,1H3;2H2,1H3 |
| InChIKey | OEBHJWXPZSFVNS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|