C15H12Cl4N8O4 — CID 43834847
1-N',3-N'-bis(4,5-dichloro-2-nitroanilino)propanediimidamide (PubChem CID 43834847) has the molecular formula C15H12Cl4N8O4 and a molecular weight of 510.13 g/mol. Its IUPAC name is 1-N',3-N'-bis(4,5-dichloro-2-nitroanilino)propanediimidamide.
| Compound Name | 1-N',3-N'-bis(4,5-dichloro-2-nitroanilino)propanediimidamide |
|---|---|
| PubChem CID | 43834847 |
| Molecular Formula | C15H12Cl4N8O4 |
| Molecular Weight | 510.13 g/mol |
| Exact Mass | 507.97 |
| IUPAC Name | 1-N',3-N'-bis(4,5-dichloro-2-nitroanilino)propanediimidamide |
| SMILES | N/C(C/C(N)=N/Nc1cc(Cl)c(Cl)cc1[N+](=O)[O-])=N\Nc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12Cl4N8O4/c16-6-1-10(12(26(28)29)3-8(6)18)22-24-14(20)5-15(21)25-23-11-2-7(17)9(19)4-13(11)27(30)31/h1-4,22-23H,5H2,(H2,20,24)(H2,21,25) |
| InChIKey | OONRCQGEWXCFEU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 187.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.13 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|