About ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate
ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate (PubChem CID 13332178) has the molecular formula C17H15Cl2N3O4
and a molecular weight of 396.23 g/mol. Its IUPAC name is ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate.
Molecular Properties
| Compound Name | ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate |
| PubChem CID | 13332178 |
| Molecular Formula | C17H15Cl2N3O4 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate |
| SMILES | CCOC(=O)C/C(=N\Nc1cc(Cl)c(Cl)cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H15Cl2N3O4/c1-2-26-17(23)10-14(11-6-4-3-5-7-11)20-21-15-8-12(18)13(19)9-16(15)22(24)25/h3-9,21H,2,10H2,1H3/b20-14+ |
| InChIKey | VBJLHAYARSXOID-XSFVSMFZSA-N |
| XLogP | 4.67 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate?
The IUPAC name of ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate (CID 13332178) is ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate.
What is the SMILES notation for ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate?
The canonical SMILES for ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate is CCOC(=O)C/C(=N\Nc1cc(Cl)c(Cl)cc1[N+](=O)[O-])c1ccccc1.
What is the InChIKey of ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate?
The InChIKey is VBJLHAYARSXOID-XSFVSMFZSA-N. The full InChI is InChI=1S/C17H15Cl2N3O4/c1-2-26-17(23)10-14(11-6-4-3-5-7-11)20-21-15-8-12(18)13(19)9-16(15)22(24)25/h3-9,21H,2,10H2,1H3/b20-14+.
What are the key properties of ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate?
ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate has a molecular weight of 396.23 g/mol, XLogP of 4.67, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3E)-3-[(4,5-dichloro-2-nitrophenyl)hydrazinylidene]-3-phenylpropanoate is sourced from PubChem (CID 13332178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).