C12H16N4O6S — CID 4174969
ethyl 3-amino-3-[(4-methylsulfonyl-2-nitrophenyl)hydrazinylidene]propanoate (PubChem CID 4174969) has the molecular formula C12H16N4O6S and a molecular weight of 344.35 g/mol. Its IUPAC name is ethyl 3-amino-3-[(4-methylsulfonyl-2-nitrophenyl)hydrazinylidene]propanoate.
| Compound Name | ethyl 3-amino-3-[(4-methylsulfonyl-2-nitrophenyl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 4174969 |
| Molecular Formula | C12H16N4O6S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | ethyl 3-amino-3-[(4-methylsulfonyl-2-nitrophenyl)hydrazinylidene]propanoate |
| SMILES | CCOC(=O)CC(N)=NNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N4O6S/c1-3-22-12(17)7-11(13)15-14-9-5-4-8(23(2,20)21)6-10(9)16(18)19/h4-6,14H,3,7H2,1-2H3,(H2,13,15) |
| InChIKey | ADDQJNJMNNBKOX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 153.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|