C10H11N5O6 — CID 10685397
ethyl (2E)-2-amino-2-[(2,4-dinitrophenyl)hydrazinylidene]acetate (PubChem CID 10685397) has the molecular formula C10H11N5O6 and a molecular weight of 297.23 g/mol. Its IUPAC name is ethyl (2E)-2-amino-2-[(2,4-dinitrophenyl)hydrazinylidene]acetate.
| Compound Name | ethyl (2E)-2-amino-2-[(2,4-dinitrophenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 10685397 |
| Molecular Formula | C10H11N5O6 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | ethyl (2E)-2-amino-2-[(2,4-dinitrophenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(N)=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N5O6/c1-2-21-10(16)9(11)13-12-7-4-3-6(14(17)18)5-8(7)15(19)20/h3-5,12H,2H2,1H3,(H2,11,13) |
| InChIKey | IRBBPQWSAABNCS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 162.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|