C19H18N4O9 — CID 10813253
ethyl (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-3-methoxycarbonyloxy-3-phenylpropanoate (PubChem CID 10813253) has the molecular formula C19H18N4O9 and a molecular weight of 446.37 g/mol. Its IUPAC name is ethyl (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-3-methoxycarbonyloxy-3-phenylpropanoate.
| Compound Name | ethyl (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-3-methoxycarbonyloxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 10813253 |
| Molecular Formula | C19H18N4O9 |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | ethyl (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-3-methoxycarbonyloxy-3-phenylpropanoate |
| SMILES | CCOC(=O)/C(=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(OC(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C19H18N4O9/c1-3-31-18(24)16(17(32-19(25)30-2)12-7-5-4-6-8-12)21-20-14-10-9-13(22(26)27)11-15(14)23(28)29/h4-11,17,20H,3H2,1-2H3/b21-16- |
| InChIKey | GQTZZFMGUAEOFO-PGMHBOJBSA-N |
| XLogP | 3.36 |
| TPSA | 172.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|