C21H27N5O7S — CID 5238261
ethyl 2,4-dimethyl-5-[C-methyl-N-(4-morpholin-4-ylsulfonyl-2-nitroanilino)carbonimidoyl]-1H-pyrrole-3-carboxylate (PubChem CID 5238261) has the molecular formula C21H27N5O7S and a molecular weight of 493.54 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-[C-methyl-N-(4-morpholin-4-ylsulfonyl-2-nitroanilino)carbonimidoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-[C-methyl-N-(4-morpholin-4-ylsulfonyl-2-nitroanilino)carbonimidoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 5238261 |
| Molecular Formula | C21H27N5O7S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | ethyl 2,4-dimethyl-5-[C-methyl-N-(4-morpholin-4-ylsulfonyl-2-nitroanilino)carbonimidoyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(C)=NNc2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C21H27N5O7S/c1-5-33-21(27)19-13(2)20(22-14(19)3)15(4)23-24-17-7-6-16(12-18(17)26(28)29)34(30,31)25-8-10-32-11-9-25/h6-7,12,22,24H,5,8-11H2,1-4H3 |
| InChIKey | LPOKGBUOVXKKPQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|