C17H20N4O4S2 — CID 9142489
N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline (PubChem CID 9142489) has the molecular formula C17H20N4O4S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 9142489 |
| Molecular Formula | C17H20N4O4S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
| SMILES | C/C(=N/Nc1ccc(S(=O)(=O)N2CCCC2)cc1[N+](=O)[O-])c1ccc(C)s1 |
| InChI | InChI=1S/C17H20N4O4S2/c1-12-5-8-17(26-12)13(2)18-19-15-7-6-14(11-16(15)21(22)23)27(24,25)20-9-3-4-10-20/h5-8,11,19H,3-4,9-10H2,1-2H3/b18-13- |
| InChIKey | KFABULCTROJSHU-AQTBWJFISA-N |
| XLogP | 3.59 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|