C17H26N4O4S — CID 6251475
N-[(Z)-5-methylhexan-2-ylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline (PubChem CID 6251475) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[(Z)-5-methylhexan-2-ylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[(Z)-5-methylhexan-2-ylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 6251475 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-[(Z)-5-methylhexan-2-ylideneamino]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
| SMILES | C/C(CCC(C)C)=N/Nc1ccc(S(=O)(=O)N2CCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N4O4S/c1-13(2)6-7-14(3)18-19-16-9-8-15(12-17(16)21(22)23)26(24,25)20-10-4-5-11-20/h8-9,12-13,19H,4-7,10-11H2,1-3H3/b18-14- |
| InChIKey | MIYYRNGLSQPTIT-JXAWBTAJSA-N |
| XLogP | 3.60 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|