C19H22N4O6S — CID 3893577
5-methoxy-2-[C-methyl-N-(2-nitro-4-pyrrolidin-1-ylsulfonylanilino)carbonimidoyl]phenol (PubChem CID 3893577) has the molecular formula C19H22N4O6S and a molecular weight of 434.47 g/mol. Its IUPAC name is 5-methoxy-2-[C-methyl-N-(2-nitro-4-pyrrolidin-1-ylsulfonylanilino)carbonimidoyl]phenol.
| Compound Name | 5-methoxy-2-[C-methyl-N-(2-nitro-4-pyrrolidin-1-ylsulfonylanilino)carbonimidoyl]phenol |
|---|---|
| PubChem CID | 3893577 |
| Molecular Formula | C19H22N4O6S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 5-methoxy-2-[C-methyl-N-(2-nitro-4-pyrrolidin-1-ylsulfonylanilino)carbonimidoyl]phenol |
| SMILES | COc1ccc(C(C)=NNc2ccc(S(=O)(=O)N3CCCC3)cc2[N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C19H22N4O6S/c1-13(16-7-5-14(29-2)11-19(16)24)20-21-17-8-6-15(12-18(17)23(25)26)30(27,28)22-9-3-4-10-22/h5-8,11-12,21,24H,3-4,9-10H2,1-2H3 |
| InChIKey | FNTHNSWOANVHMR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|