C16H15N5O6 — CID 73184186
ethyl 3-(4-nitrophenyl)-3-[(3-nitro-2-pyridinyl)hydrazinylidene]propanoate (PubChem CID 73184186) has the molecular formula C16H15N5O6 and a molecular weight of 373.33 g/mol. Its IUPAC name is ethyl 3-(4-nitrophenyl)-3-[(3-nitro-2-pyridinyl)hydrazinylidene]propanoate.
| Compound Name | ethyl 3-(4-nitrophenyl)-3-[(3-nitro-2-pyridinyl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 73184186 |
| Molecular Formula | C16H15N5O6 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | ethyl 3-(4-nitrophenyl)-3-[(3-nitro-2-pyridinyl)hydrazinylidene]propanoate |
| SMILES | CCOC(=O)CC(=NNc1ncccc1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15N5O6/c1-2-27-15(22)10-13(11-5-7-12(8-6-11)20(23)24)18-19-16-14(21(25)26)4-3-9-17-16/h3-9H,2,10H2,1H3,(H,17,19) |
| InChIKey | AJEBUPSDJCMQQV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 149.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|