C18H19BrN4O6 — CID 126078647
ethyl 2-[5-bromo-2-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126078647) has the molecular formula C18H19BrN4O6 and a molecular weight of 467.28 g/mol. Its IUPAC name is ethyl 2-[5-bromo-2-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[5-bromo-2-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126078647 |
| Molecular Formula | C18H19BrN4O6 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | ethyl 2-[5-bromo-2-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Br)c(/C=N\Nc2ncccc2[N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C18H19BrN4O6/c1-3-27-15-8-12(13(19)9-16(15)29-11-17(24)28-4-2)10-21-22-18-14(23(25)26)6-5-7-20-18/h5-10H,3-4,11H2,1-2H3,(H,20,22)/b21-10- |
| InChIKey | JNDXUOQCWNMWQV-FBHDLOMBSA-N |
| XLogP | 3.54 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|