C14H12Br2N4O4 — CID 137076452
2,3-dibromo-6-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol (PubChem CID 137076452) has the molecular formula C14H12Br2N4O4 and a molecular weight of 460.08 g/mol. Its IUPAC name is 2,3-dibromo-6-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,3-dibromo-6-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 137076452 |
| Molecular Formula | C14H12Br2N4O4 |
| Molecular Weight | 460.08 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | 2,3-dibromo-6-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenol |
| SMILES | CCOc1cc(/C=N\Nc2ncccc2[N+](=O)[O-])c(Br)c(Br)c1O |
| InChI | InChI=1S/C14H12Br2N4O4/c1-2-24-10-6-8(11(15)12(16)13(10)21)7-18-19-14-9(20(22)23)4-3-5-17-14/h3-7,21H,2H2,1H3,(H,17,19)/b18-7- |
| InChIKey | FLZOSZKNWLZAQU-WSVATBPTSA-N |
| XLogP | 4.07 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.08 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|