C18H17Br2N3O6 — CID 136689283
N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide (PubChem CID 136689283) has the molecular formula C18H17Br2N3O6 and a molecular weight of 531.16 g/mol. Its IUPAC name is N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide.
| Compound Name | N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 136689283 |
| Molecular Formula | C18H17Br2N3O6 |
| Molecular Weight | 531.16 g/mol |
| Exact Mass | 528.95 |
| IUPAC Name | N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)COc2ccc(C)cc2[N+](=O)[O-])c(Br)c(Br)c1O |
| InChI | InChI=1S/C18H17Br2N3O6/c1-3-28-14-7-11(16(19)17(20)18(14)25)8-21-22-15(24)9-29-13-5-4-10(2)6-12(13)23(26)27/h4-8,25H,3,9H2,1-2H3,(H,22,24)/b21-8- |
| InChIKey | XTUDORGATHXLOL-WNFQYIGGSA-N |
| XLogP | 4.06 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.16 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|