C17H15Br2ClN2O3 — CID 135926015
2-chloro-N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methylbenzamide (PubChem CID 135926015) has the molecular formula C17H15Br2ClN2O3 and a molecular weight of 490.58 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 135926015 |
| Molecular Formula | C17H15Br2ClN2O3 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 487.91 |
| IUPAC Name | 2-chloro-N-[(Z)-(2,3-dibromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methylbenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(C)cc2Cl)c(Br)c(Br)c1O |
| InChI | InChI=1S/C17H15Br2ClN2O3/c1-3-25-13-7-10(14(18)15(19)16(13)23)8-21-22-17(24)11-5-4-9(2)6-12(11)20/h4-8,23H,3H2,1-2H3,(H,22,24)/b21-8- |
| InChIKey | BMFGLVIJSVNBCP-WNFQYIGGSA-N |
| XLogP | 5.04 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|