C18H18BrN3O6 — CID 136755616
N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide (PubChem CID 136755616) has the molecular formula C18H18BrN3O6 and a molecular weight of 452.26 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide.
| Compound Name | N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 136755616 |
| Molecular Formula | C18H18BrN3O6 |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | N-[(Z)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)COc2ccc(C)cc2[N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C18H18BrN3O6/c1-3-27-16-8-12(7-13(19)18(16)24)9-20-21-17(23)10-28-15-5-4-11(2)6-14(15)22(25)26/h4-9,24H,3,10H2,1-2H3,(H,21,23)/b20-9- |
| InChIKey | ZOHJAOZDEDETSA-UKWGHVSLSA-N |
| XLogP | 3.30 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|