C18H18IN3O6 — CID 135589998
N-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide (PubChem CID 135589998) has the molecular formula C18H18IN3O6 and a molecular weight of 499.26 g/mol. Its IUPAC name is N-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide.
| Compound Name | N-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 135589998 |
| Molecular Formula | C18H18IN3O6 |
| Molecular Weight | 499.26 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | N-[(E)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-2-(4-methyl-2-nitrophenoxy)acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)COc2ccc(C)cc2[N+](=O)[O-])cc(I)c1O |
| InChI | InChI=1S/C18H18IN3O6/c1-3-27-16-8-12(7-13(19)18(16)24)9-20-21-17(23)10-28-15-5-4-11(2)6-14(15)22(25)26/h4-9,24H,3,10H2,1-2H3,(H,21,23)/b20-9+ |
| InChIKey | WMDQEZSYTKAQHC-AWQFTUOYSA-N |
| XLogP | 3.14 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|