C19H20Br2N2O4 — CID 135881814
2-(2-bromo-4,6-dimethylphenoxy)-N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135881814) has the molecular formula C19H20Br2N2O4 and a molecular weight of 500.19 g/mol. Its IUPAC name is 2-(2-bromo-4,6-dimethylphenoxy)-N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4,6-dimethylphenoxy)-N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135881814 |
| Molecular Formula | C19H20Br2N2O4 |
| Molecular Weight | 500.19 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | 2-(2-bromo-4,6-dimethylphenoxy)-N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)COc2c(C)cc(C)cc2Br)cc(Br)c1O |
| InChI | InChI=1S/C19H20Br2N2O4/c1-4-26-16-8-13(7-14(20)18(16)25)9-22-23-17(24)10-27-19-12(3)5-11(2)6-15(19)21/h5-9,25H,4,10H2,1-3H3,(H,23,24)/b22-9+ |
| InChIKey | IUWYPWUIMIJHOT-LSFURLLWSA-N |
| XLogP | 4.46 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.19 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|