C16H15BrN4O6 — CID 126109189
2-[2-bromo-6-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 126109189) has the molecular formula C16H15BrN4O6 and a molecular weight of 439.22 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126109189 |
| Molecular Formula | C16H15BrN4O6 |
| Molecular Weight | 439.22 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(/C=N\Nc2ncccc2[N+](=O)[O-])cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C16H15BrN4O6/c1-2-26-13-7-10(6-11(17)15(13)27-9-14(22)23)8-19-20-16-12(21(24)25)4-3-5-18-16/h3-8H,2,9H2,1H3,(H,18,20)(H,22,23)/b19-8- |
| InChIKey | ULKPVLPFRZHHRE-UWVJOHFNSA-N |
| XLogP | 3.06 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|