C15H12I2N4O5 — CID 126108025
methyl 2-[2,6-diiodo-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126108025) has the molecular formula C15H12I2N4O5 and a molecular weight of 582.09 g/mol. Its IUPAC name is methyl 2-[2,6-diiodo-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2,6-diiodo-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126108025 |
| Molecular Formula | C15H12I2N4O5 |
| Molecular Weight | 582.09 g/mol |
| Exact Mass | 581.89 |
| IUPAC Name | methyl 2-[2,6-diiodo-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=N\Nc2ncccc2[N+](=O)[O-])cc1I |
| InChI | InChI=1S/C15H12I2N4O5/c1-25-13(22)8-26-14-10(16)5-9(6-11(14)17)7-19-20-15-12(21(23)24)3-2-4-18-15/h2-7H,8H2,1H3,(H,18,20)/b19-7- |
| InChIKey | QLICYPOAIAVTGL-GXHLCREISA-N |
| XLogP | 3.20 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.09 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|