C20H13I2N5O3 — CID 126101561
2-[[2,6-diiodo-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126101561) has the molecular formula C20H13I2N5O3 and a molecular weight of 625.16 g/mol. Its IUPAC name is 2-[[2,6-diiodo-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-diiodo-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126101561 |
| Molecular Formula | C20H13I2N5O3 |
| Molecular Weight | 625.16 g/mol |
| Exact Mass | 624.91 |
| IUPAC Name | 2-[[2,6-diiodo-4-[(Z)-[(3-nitro-2-pyridinyl)hydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(I)cc(/C=N\Nc2ncccc2[N+](=O)[O-])cc1I |
| InChI | InChI=1S/C20H13I2N5O3/c21-16-8-13(11-25-26-20-18(27(28)29)6-3-7-24-20)9-17(22)19(16)30-12-15-5-2-1-4-14(15)10-23/h1-9,11H,12H2,(H,24,26)/b25-11- |
| InChIKey | GVHIJBIYPCOYPD-GATIEOLUSA-N |
| XLogP | 5.10 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.16 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|