C19H14Cl2N4O3 — CID 126103139
N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126103139) has the molecular formula C19H14Cl2N4O3 and a molecular weight of 417.25 g/mol. Its IUPAC name is N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126103139 |
| Molecular Formula | C19H14Cl2N4O3 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1N/N=C\c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2N4O3/c20-15-6-5-14(17(21)10-15)12-28-16-7-3-13(4-8-16)11-23-24-19-18(25(26)27)2-1-9-22-19/h1-11H,12H2,(H,22,24)/b23-11- |
| InChIKey | MBJLCGHEDHOOEK-KSEXSDGBSA-N |
| XLogP | 5.32 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|