C16H10Cl2N4O3 — CID 126100606
N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-3-nitropyridin-2-amine (PubChem CID 126100606) has the molecular formula C16H10Cl2N4O3 and a molecular weight of 377.19 g/mol. Its IUPAC name is N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-3-nitropyridin-2-amine.
| Compound Name | N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126100606 |
| Molecular Formula | C16H10Cl2N4O3 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1N/N=C\c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C16H10Cl2N4O3/c17-10-3-5-13(18)12(8-10)15-6-4-11(25-15)9-20-21-16-14(22(23)24)2-1-7-19-16/h1-9H,(H,19,21)/b20-9- |
| InChIKey | CUUGGRJNXOJYML-UKWGHVSLSA-N |
| XLogP | 5.00 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|