C17H11Cl2N3O3 — CID 6063608
N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4-nitroaniline (PubChem CID 6063608) has the molecular formula C17H11Cl2N3O3 and a molecular weight of 376.20 g/mol. Its IUPAC name is N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4-nitroaniline.
| Compound Name | N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 6063608 |
| Molecular Formula | C17H11Cl2N3O3 |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\c2ccc(-c3ccc(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C17H11Cl2N3O3/c18-11-1-7-15(16(19)9-11)17-8-6-14(25-17)10-20-21-12-2-4-13(5-3-12)22(23)24/h1-10,21H/b20-10- |
| InChIKey | COHXYAIAOKDVTK-JMIUGGIZSA-N |
| XLogP | 5.61 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|