C13H12ClN3O4 — CID 7224716
2-[(2Z)-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]ethanol (PubChem CID 7224716) has the molecular formula C13H12ClN3O4 and a molecular weight of 309.71 g/mol. Its IUPAC name is 2-[(2Z)-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]ethanol.
| Compound Name | 2-[(2Z)-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]ethanol |
|---|---|
| PubChem CID | 7224716 |
| Molecular Formula | C13H12ClN3O4 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-[(2Z)-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]ethanol |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(/C=N\NCCO)o2)c(Cl)c1 |
| InChI | InChI=1S/C13H12ClN3O4/c14-12-7-9(17(19)20)1-3-11(12)13-4-2-10(21-13)8-16-15-5-6-18/h1-4,7-8,15,18H,5-6H2/b16-8- |
| InChIKey | YOEPVJWWZUPDQN-PXNMLYILSA-N |
| XLogP | 2.42 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|