C17H10ClF3N4O3 — CID 126090826
N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126090826) has the molecular formula C17H10ClF3N4O3 and a molecular weight of 410.74 g/mol. Its IUPAC name is N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126090826 |
| Molecular Formula | C17H10ClF3N4O3 |
| Molecular Weight | 410.74 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | N-[(Z)-[5-(4-chloro-2-nitrophenyl)furan-2-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1-c1ccc(/C=N\Nc2ccc(C(F)(F)F)cn2)o1 |
| InChI | InChI=1S/C17H10ClF3N4O3/c18-11-2-4-13(14(7-11)25(26)27)15-5-3-12(28-15)9-23-24-16-6-1-10(8-22-16)17(19,20)21/h1-9H,(H,22,24)/b23-9- |
| InChIKey | CVVXLWMDXIKSSI-AQHIEDMUSA-N |
| XLogP | 5.37 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.74 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|