C13H8BrF3N4O3 — CID 137043402
4-bromo-2-nitro-6-[(E)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenol (PubChem CID 137043402) has the molecular formula C13H8BrF3N4O3 and a molecular weight of 405.13 g/mol. Its IUPAC name is 4-bromo-2-nitro-6-[(E)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-nitro-6-[(E)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 137043402 |
| Molecular Formula | C13H8BrF3N4O3 |
| Molecular Weight | 405.13 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | 4-bromo-2-nitro-6-[(E)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenol |
| SMILES | O=[N+]([O-])c1cc(Br)cc(/C=N/Nc2ccc(C(F)(F)F)cn2)c1O |
| InChI | InChI=1S/C13H8BrF3N4O3/c14-9-3-7(12(22)10(4-9)21(23)24)5-19-20-11-2-1-8(6-18-11)13(15,16)17/h1-6,22H,(H,18,20)/b19-5+ |
| InChIKey | PVPJVOJRPIYTCV-PTXOJBNSSA-N |
| XLogP | 3.92 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.13 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|