C20H15F3N4O3 — CID 126103998
N-[(Z)-[2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126103998) has the molecular formula C20H15F3N4O3 and a molecular weight of 416.36 g/mol. Its IUPAC name is N-[(Z)-[2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126103998 |
| Molecular Formula | C20H15F3N4O3 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-[(Z)-[2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccc(COc2ccccc2/C=N\Nc2ccc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C20H15F3N4O3/c21-20(22,23)16-8-9-19(24-12-16)26-25-11-15-5-1-2-7-18(15)30-13-14-4-3-6-17(10-14)27(28)29/h1-12H,13H2,(H,24,26)/b25-11- |
| InChIKey | NCAWNGGNQRCBES-GATIEOLUSA-N |
| XLogP | 5.03 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|