C25H17F3N4O5 — CID 126105314
2-nitro-N-[(Z)-[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 126105314) has the molecular formula C25H17F3N4O5 and a molecular weight of 510.43 g/mol. Its IUPAC name is 2-nitro-N-[(Z)-[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-(trifluoromethyl)aniline.
| Compound Name | 2-nitro-N-[(Z)-[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126105314 |
| Molecular Formula | C25H17F3N4O5 |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 2-nitro-N-[(Z)-[2-[(3-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cccc(COc2ccc3ccccc3c2/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H17F3N4O5/c26-25(27,28)18-9-10-22(23(13-18)32(35)36)30-29-14-21-20-7-2-1-5-17(20)8-11-24(21)37-15-16-4-3-6-19(12-16)31(33)34/h1-14,30H,15H2/b29-14- |
| InChIKey | RRSOHHKLYNHCLA-NUJZUDFISA-N |
| XLogP | 6.70 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|