C24H14F5N3O3 — CID 5182434
2,3,4,5,6-pentafluoro-N-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]aniline (PubChem CID 5182434) has the molecular formula C24H14F5N3O3 and a molecular weight of 487.38 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 5182434 |
| Molecular Formula | C24H14F5N3O3 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[2-[(4-nitrophenyl)methoxy]naphthalen-1-yl]methylideneamino]aniline |
| SMILES | O=[N+]([O-])c1ccc(COc2ccc3ccccc3c2C=NNc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H14F5N3O3/c25-19-20(26)22(28)24(23(29)21(19)27)31-30-11-17-16-4-2-1-3-14(16)7-10-18(17)35-12-13-5-8-15(9-6-13)32(33)34/h1-11,31H,12H2 |
| InChIKey | GMLIJYQEKBNFBQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|