C26H20FN3O5 — CID 4276527
N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(4-nitrophenoxy)acetamide (PubChem CID 4276527) has the molecular formula C26H20FN3O5 and a molecular weight of 473.46 g/mol. Its IUPAC name is N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 4276527 |
| Molecular Formula | C26H20FN3O5 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[[2-[(4-fluorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(4-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)NN=Cc1c(OCc2ccc(F)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C26H20FN3O5/c27-20-8-5-18(6-9-20)16-35-25-14-7-19-3-1-2-4-23(19)24(25)15-28-29-26(31)17-34-22-12-10-21(11-13-22)30(32)33/h1-15H,16-17H2,(H,29,31) |
| InChIKey | XHNLWPPRXVJGRE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|