C20H12F6N2O — CID 5080899
2,3,4,5,6-pentafluoro-N-[[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]aniline (PubChem CID 5080899) has the molecular formula C20H12F6N2O and a molecular weight of 410.32 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 5080899 |
| Molecular Formula | C20H12F6N2O |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]aniline |
| SMILES | Fc1ccc(COc2ccccc2C=NNc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H12F6N2O/c21-13-7-5-11(6-8-13)10-29-14-4-2-1-3-12(14)9-27-28-20-18(25)16(23)15(22)17(24)19(20)26/h1-9,28H,10H2 |
| InChIKey | RRXUZZNGAAMFTN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|